About cadmium(2+);ethyl sulfate
cadmium(2+);ethyl sulfate (PubChem CID 57361489) has the molecular formula C4H10CdO8S2
and a molecular weight of 362.66 g/mol. Its IUPAC name is cadmium(2+);ethyl sulfate.
Molecular Properties
| Compound Name | cadmium(2+);ethyl sulfate |
| PubChem CID | 57361489 |
| Molecular Formula | C4H10CdO8S2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 363.89 |
| IUPAC Name | cadmium(2+);ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CCOS(=O)(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C2H6O4S.Cd/c2*1-2-6-7(3,4)5;/h2*2H2,1H3,(H,3,4,5);/q;;+2/p-2 |
| InChIKey | WNBJBTPPHNVAKT-UHFFFAOYSA-L |
| XLogP | -1.04 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);ethyl sulfate?
The IUPAC name of cadmium(2+);ethyl sulfate (CID 57361489) is cadmium(2+);ethyl sulfate.
What is the SMILES notation for cadmium(2+);ethyl sulfate?
The canonical SMILES for cadmium(2+);ethyl sulfate is CCOS(=O)(=O)[O-].CCOS(=O)(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);ethyl sulfate?
The InChIKey is WNBJBTPPHNVAKT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H6O4S.Cd/c2*1-2-6-7(3,4)5;/h2*2H2,1H3,(H,3,4,5);/q;;+2/p-2.
What are the key properties of cadmium(2+);ethyl sulfate?
cadmium(2+);ethyl sulfate has a molecular weight of 362.66 g/mol, XLogP of -1.04, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);ethyl sulfate is sourced from PubChem (CID 57361489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).