C12H30N2O6S — CID 139795238
ethyl sulfate;2-methylprop-2-enoate;bis(trimethylazanium) (PubChem CID 139795238) has the molecular formula C12H30N2O6S and a molecular weight of 330.45 g/mol. Its IUPAC name is ethyl sulfate;2-methylprop-2-enoate;bis(trimethylazanium).
| Compound Name | ethyl sulfate;2-methylprop-2-enoate;bis(trimethylazanium) |
|---|---|
| PubChem CID | 139795238 |
| Molecular Formula | C12H30N2O6S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | ethyl sulfate;2-methylprop-2-enoate;bis(trimethylazanium) |
| SMILES | C=C(C)C(=O)[O-].CCOS(=O)(=O)[O-].C[NH+](C)C.C[NH+](C)C |
| InChI | InChI=1S/C4H6O2.2C3H9N.C2H6O4S/c1-3(2)4(5)6;2*1-4(2)3;1-2-6-7(3,4)5/h1H2,2H3,(H,5,6);2*1-3H3;2H2,1H3,(H,3,4,5) |
| InChIKey | KSQYBRBOXNSRPV-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|