C11H23NO6S — CID 87507066
dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;propyl sulfate (PubChem CID 87507066) has the molecular formula C11H23NO6S and a molecular weight of 297.37 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;propyl sulfate.
| Compound Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;propyl sulfate |
|---|---|
| PubChem CID | 87507066 |
| Molecular Formula | C11H23NO6S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;propyl sulfate |
| SMILES | C=C(C)C(=O)OCC[NH+](C)C.CCCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H15NO2.C3H8O4S/c1-7(2)8(10)11-6-5-9(3)4;1-2-3-7-8(4,5)6/h1,5-6H2,2-4H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | KHUPYNZSCLSONO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|