C11H21NO5S — CID 168866214
1-[methyl-[3-(2-methylprop-2-enoyloxy)propyl]azaniumyl]propane-1-sulfonate (PubChem CID 168866214) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-[methyl-[3-(2-methylprop-2-enoyloxy)propyl]azaniumyl]propane-1-sulfonate.
| Compound Name | 1-[methyl-[3-(2-methylprop-2-enoyloxy)propyl]azaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 168866214 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[methyl-[3-(2-methylprop-2-enoyloxy)propyl]azaniumyl]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)OCCC[NH+](C)C(CC)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H21NO5S/c1-5-10(18(14,15)16)12(4)7-6-8-17-11(13)9(2)3/h10H,2,5-8H2,1,3-4H3,(H,14,15,16) |
| InChIKey | BUVSAHRTZWIHFI-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|