C7H10F3NO5S — CID 163681992
2-(2-methylprop-2-enoyloxy)-N-(trifluoromethylsulfonyl)ethanamine oxide (PubChem CID 163681992) has the molecular formula C7H10F3NO5S and a molecular weight of 277.22 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)-N-(trifluoromethylsulfonyl)ethanamine oxide.
| Compound Name | 2-(2-methylprop-2-enoyloxy)-N-(trifluoromethylsulfonyl)ethanamine oxide |
|---|---|
| PubChem CID | 163681992 |
| Molecular Formula | C7H10F3NO5S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)-N-(trifluoromethylsulfonyl)ethanamine oxide |
| SMILES | C=C(C)C(=O)OCC[NH+]([O-])S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO5S/c1-5(2)6(12)16-4-3-11(13)17(14,15)7(8,9)10/h11H,1,3-4H2,2H3 |
| InChIKey | JLPCDUBZSMETBL-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|