C10H9F10NO6S2 — CID 87903552
2-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 87903552) has the molecular formula C10H9F10NO6S2 and a molecular weight of 493.30 g/mol. Its IUPAC name is 2-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87903552 |
| Molecular Formula | C10H9F10NO6S2 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.97 |
| IUPAC Name | 2-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F10NO6S2/c1-5(2)6(22)27-4-3-21(28(23,24)9(17,18)7(11,12)13)29(25,26)10(19,20)8(14,15)16/h1,3-4H2,2H3 |
| InChIKey | YYYZJDDAPRHCAK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|