C10H9F9O3 — CID 175028750
2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl 2-methylprop-2-enoate (PubChem CID 175028750) has the molecular formula C10H9F9O3 and a molecular weight of 348.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175028750 |
| Molecular Formula | C10H9F9O3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F9O3/c1-5(2)6(20)21-3-4-22-10(18,19)8(13,14)7(11,12)9(15,16)17/h1,3-4H2,2H3 |
| InChIKey | QMHRSIQGYGYBCS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|