C14H11F15O2 — CID 122657835
3,3,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecyl 2-methylprop-2-enoate (PubChem CID 122657835) has the molecular formula C14H11F15O2 and a molecular weight of 496.21 g/mol. Its IUPAC name is 3,3,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecyl 2-methylprop-2-enoate.
| Compound Name | 3,3,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122657835 |
| Molecular Formula | C14H11F15O2 |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 3,3,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F15O2/c1-6(2)7(30)31-4-3-8(15,16)5-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h1,3-5H2,2H3 |
| InChIKey | BYCGVBGFHIREDV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|