C11H9F11O4S — CID 122423662
[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethylsulfonyl)hexyl] 2-methylprop-2-enoate (PubChem CID 122423662) has the molecular formula C11H9F11O4S and a molecular weight of 446.23 g/mol. Its IUPAC name is [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethylsulfonyl)hexyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethylsulfonyl)hexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122423662 |
| Molecular Formula | C11H9F11O4S |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethylsulfonyl)hexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9F11O4S/c1-5(2)6(23)26-4-3-7(12,13)8(14,15)9(16,10(17,18)19)27(24,25)11(20,21)22/h1,3-4H2,2H3 |
| InChIKey | ZKWUCPDJKRLTJJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|