C11H15F4NO4S — CID 89309082
2-[(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 89309082) has the molecular formula C11H15F4NO4S and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-[(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89309082 |
| Molecular Formula | C11H15F4NO4S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC(F)(F)C(F)(F)S |
| InChI | InChI=1S/C11H15F4NO4S/c1-7(2)8(17)19-6-4-16-9(18)20-5-3-10(12,13)11(14,15)21/h21H,1,3-6H2,2H3,(H,16,18) |
| InChIKey | MZFQIMUCJDXIDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|