C11H14F5NO6 — CID 89368142
2-[[2-(1,1-difluoro-2-fluorooxyethoxy)-2,2-difluoroethoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 89368142) has the molecular formula C11H14F5NO6 and a molecular weight of 351.22 g/mol. Its IUPAC name is 2-[[2-(1,1-difluoro-2-fluorooxyethoxy)-2,2-difluoroethoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-(1,1-difluoro-2-fluorooxyethoxy)-2,2-difluoroethoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89368142 |
| Molecular Formula | C11H14F5NO6 |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[[2-(1,1-difluoro-2-fluorooxyethoxy)-2,2-difluoroethoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(F)(F)OC(F)(F)COF |
| InChI | InChI=1S/C11H14F5NO6/c1-7(2)8(18)20-4-3-17-9(19)21-5-10(12,13)23-11(14,15)6-22-16/h1,3-6H2,2H3,(H,17,19) |
| InChIKey | YEFPGXHYKMOGFB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|