C9H11F5NO6S2- — CID 170776197
3-(2-methylprop-2-enoyloxy)propylsulfonyl-(1,1,2,2,2-pentafluoroethylsulfonyl)azanide (PubChem CID 170776197) has the molecular formula C9H11F5NO6S2- and a molecular weight of 388.31 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(1,1,2,2,2-pentafluoroethylsulfonyl)azanide.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
|---|---|
| PubChem CID | 170776197 |
| Molecular Formula | C9H11F5NO6S2- |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(1,1,2,2,2-pentafluoroethylsulfonyl)azanide |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F5NO6S2/c1-6(2)7(16)21-4-3-5-22(17,18)15-23(19,20)9(13,14)8(10,11)12/h1,3-5H2,2H3/q-1 |
| InChIKey | YWQBPWYDEKNOOT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|