C18H20F14O4S — CID 59689350
2-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylethyl 2-methylprop-2-enoate (PubChem CID 59689350) has the molecular formula C18H20F14O4S and a molecular weight of 598.39 g/mol. Its IUPAC name is 2-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylethyl 2-methylprop-2-enoate.
| Compound Name | 2-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59689350 |
| Molecular Formula | C18H20F14O4S |
| Molecular Weight | 598.39 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 2-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)CCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F14O4S/c1-10(2)12(33)36-5-7-37(34,35)6-3-4-11(8-13(19,15(21,22)23)16(24,25)26)9-14(20,17(27,28)29)18(30,31)32/h11H,1,3-9H2,2H3 |
| InChIKey | ZGRCQDYWZDHUPN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.39 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|