C8H11F3NNaO6S2 — CID 162420868
sodium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 162420868) has the molecular formula C8H11F3NNaO6S2 and a molecular weight of 361.30 g/mol. Its IUPAC name is sodium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | sodium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 162420868 |
| Molecular Formula | C8H11F3NNaO6S2 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | sodium 3-(2-methylprop-2-enoyloxy)propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H11F3NO6S2.Na/c1-6(2)7(13)18-4-3-5-19(14,15)12-20(16,17)8(9,10)11;/h1,3-5H2,2H3;/q-1;+1 |
| InChIKey | YNFJUIGADHOGMH-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|