C18H26F6N2O8S2 — CID 162768222
bis(trifluoromethylsulfonyl)azanide;2-[1-[2-(2-methylprop-2-enoyloxy)ethyl]pyrrolidin-1-ium-1-yl]ethyl 2-methylprop-2-enoate (PubChem CID 162768222) has the molecular formula C18H26F6N2O8S2 and a molecular weight of 576.53 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;2-[1-[2-(2-methylprop-2-enoyloxy)ethyl]pyrrolidin-1-ium-1-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;2-[1-[2-(2-methylprop-2-enoyloxy)ethyl]pyrrolidin-1-ium-1-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162768222 |
| Molecular Formula | C18H26F6N2O8S2 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;2-[1-[2-(2-methylprop-2-enoyloxy)ethyl]pyrrolidin-1-ium-1-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[N+]1(CCOC(=O)C(=C)C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H26NO4.C2F6NO4S2/c1-13(2)15(18)20-11-9-17(7-5-6-8-17)10-12-21-16(19)14(3)4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1,3,5-12H2,2,4H3;/q+1;-1 |
| InChIKey | JQZIYTDRVFKCFW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|