C9H13F3O3 — CID 121324189
2-(3,3,3-trifluoropropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 121324189) has the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3,3,3-trifluoropropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121324189 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(3,3,3-trifluoropropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCC(F)(F)F |
| InChI | InChI=1S/C9H13F3O3/c1-7(2)8(13)15-6-5-14-4-3-9(10,11)12/h1,3-6H2,2H3 |
| InChIKey | AQOAURPGRQERQI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|