C12H22F3NO5S — CID 159178640
diethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate (PubChem CID 159178640) has the molecular formula C12H22F3NO5S and a molecular weight of 349.37 g/mol. Its IUPAC name is diethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate.
| Compound Name | diethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159178640 |
| Molecular Formula | C12H22F3NO5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | diethyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(CC)CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H22NO2.CHF3O3S/c1-6-12(5,7-2)8-9-14-11(13)10(3)4;2-1(3,4)8(5,6)7/h3,6-9H2,1-2,4-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KMPHHKGCPNEBMK-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|