C17H23F10NO5S — CID 175967695
2,2,3,3,4,4,4-heptafluorobutyl-methyl-(3-methylbut-2-enyl)-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate (PubChem CID 175967695) has the molecular formula C17H23F10NO5S and a molecular weight of 543.42 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl-methyl-(3-methylbut-2-enyl)-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl-methyl-(3-methylbut-2-enyl)-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175967695 |
| Molecular Formula | C17H23F10NO5S |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl-methyl-(3-methylbut-2-enyl)-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;trifluoromethanesulfonate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(CC=C(C)C)CC(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H23F7NO2.CHF3O3S/c1-11(2)6-7-24(5,8-9-26-13(25)12(3)4)10-14(17,18)15(19,20)16(21,22)23;2-1(3,4)8(5,6)7/h6H,3,7-10H2,1-2,4-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KBTHAZCCDNCCJE-UHFFFAOYSA-M |
| XLogP | 4.40 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|