C15H25F3NO4+ — CID 175967692
methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]-(2,2,2-trifluoroethyl)azanium (PubChem CID 175967692) has the molecular formula C15H25F3NO4+ and a molecular weight of 340.36 g/mol. Its IUPAC name is methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]-(2,2,2-trifluoroethyl)azanium.
| Compound Name | methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 175967692 |
| Molecular Formula | C15H25F3NO4+ |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-(2-methylprop-2-enoyloxy)ethyl]-(2,2,2-trifluoroethyl)azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(CC(=O)OC(C)(C)C)CC(F)(F)F |
| InChI | InChI=1S/C15H25F3NO4/c1-11(2)13(21)22-8-7-19(6,10-15(16,17)18)9-12(20)23-14(3,4)5/h1,7-10H2,2-6H3/q+1 |
| InChIKey | OMGFXNDYSPXSJZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|