C11H26IN3O2 — CID 161486977
bis(2-aminoethyl)-methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium iodide (PubChem CID 161486977) has the molecular formula C11H26IN3O2 and a molecular weight of 359.25 g/mol. Its IUPAC name is bis(2-aminoethyl)-methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium iodide.
| Compound Name | bis(2-aminoethyl)-methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium iodide |
|---|---|
| PubChem CID | 161486977 |
| Molecular Formula | C11H26IN3O2 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | bis(2-aminoethyl)-methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium iodide |
| SMILES | CC(C)(C)OC(=O)C[N+](C)(CCN)CCN.[I-] |
| InChI | InChI=1S/C11H26N3O2.HI/c1-11(2,3)16-10(15)9-14(4,7-5-12)8-6-13;/h5-9,12-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | LWJUJPLHWZLJRN-UHFFFAOYSA-M |
| XLogP | -3.30 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|