C34H69N6O8+ — CID 54503007
2-(2-aminoethylamino)ethyl-[2-[2-aminoethyl-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]ethyl]-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium (PubChem CID 54503007) has the molecular formula C34H69N6O8+ and a molecular weight of 689.96 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethyl-[2-[2-aminoethyl-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]ethyl]-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium.
| Compound Name | 2-(2-aminoethylamino)ethyl-[2-[2-aminoethyl-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]ethyl]-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 54503007 |
| Molecular Formula | C34H69N6O8+ |
| Molecular Weight | 689.96 g/mol |
| Exact Mass | 689.52 |
| IUPAC Name | 2-(2-aminoethylamino)ethyl-[2-[2-aminoethyl-[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]ethyl]-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium |
| SMILES | CC(C)(C)OC(=O)CN(CCN(CCN)CC[N+](CCNCCN)(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H69N6O8/c1-31(2,3)45-27(41)23-39(24-28(42)46-32(4,5)6)19-18-38(17-14-36)20-22-40(21-16-37-15-13-35,25-29(43)47-33(7,8)9)26-30(44)48-34(10,11)12/h37H,13-26,35-36H2,1-12H3/q+1 |
| InChIKey | MYXCOBPVPUDURX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.96 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|