C14H28N2O4 — CID 143969988
tert-butyl 3-[2-aminoethyl-(2-oxo-2-propan-2-yloxyethyl)amino]propanoate (PubChem CID 143969988) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is tert-butyl 3-[2-aminoethyl-(2-oxo-2-propan-2-yloxyethyl)amino]propanoate.
| Compound Name | tert-butyl 3-[2-aminoethyl-(2-oxo-2-propan-2-yloxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 143969988 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | tert-butyl 3-[2-aminoethyl-(2-oxo-2-propan-2-yloxyethyl)amino]propanoate |
| SMILES | CC(C)OC(=O)CN(CCN)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-11(2)19-13(18)10-16(9-7-15)8-6-12(17)20-14(3,4)5/h11H,6-10,15H2,1-5H3 |
| InChIKey | XUGGEYKKVWBFSO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |