C12H28N3O2+ — CID 54127605
bis(3-aminopropyl)-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium (PubChem CID 54127605) has the molecular formula C12H28N3O2+ and a molecular weight of 246.37 g/mol. Its IUPAC name is bis(3-aminopropyl)-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium.
| Compound Name | bis(3-aminopropyl)-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
|---|---|
| PubChem CID | 54127605 |
| Molecular Formula | C12H28N3O2+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | bis(3-aminopropyl)-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
| SMILES | CC(C)(C)OC(=O)[N+](C)(CCCN)CCCN |
| InChI | InChI=1S/C12H28N3O2/c1-12(2,3)17-11(16)15(4,9-5-7-13)10-6-8-14/h5-10,13-14H2,1-4H3/q+1 |
| InChIKey | IBBRGNWZGNAOLH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|