C8H17F3N2O2 — CID 140851931
3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate (PubChem CID 140851931) has the molecular formula C8H17F3N2O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate.
| Compound Name | 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140851931 |
| Molecular Formula | C8H17F3N2O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate |
| SMILES | C[N+](C)(C)CCCN.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H17N2.C2HF3O2/c1-8(2,3)6-4-5-7;3-2(4,5)1(6)7/h4-7H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | AMKHMAVAAKSCGO-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|