About 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate
3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate (PubChem CID 140851931) has the molecular formula C8H17F3N2O2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate |
| PubChem CID | 140851931 |
| Molecular Formula | C8H17F3N2O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate |
| SMILES | C[N+](C)(C)CCCN.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H17N2.C2HF3O2/c1-8(2,3)6-4-5-7;3-2(4,5)1(6)7/h4-7H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | AMKHMAVAAKSCGO-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate?
The IUPAC name of 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate (CID 140851931) is 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate.
What is the SMILES notation for 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate?
The canonical SMILES for 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate is C[N+](C)(C)CCCN.O=C([O-])C(F)(F)F.
What is the InChIKey of 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate?
The InChIKey is AMKHMAVAAKSCGO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H17N2.C2HF3O2/c1-8(2,3)6-4-5-7;3-2(4,5)1(6)7/h4-7H2,1-3H3;(H,6,7)/q+1;/p-1.
What are the key properties of 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate?
3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate has a molecular weight of 230.23 g/mol, XLogP of -0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl(trimethyl)azanium;2,2,2-trifluoroacetate is sourced from PubChem (CID 140851931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).