About ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride
ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride (PubChem CID 158367193) has the molecular formula C15H30ClNO4
and a molecular weight of 323.86 g/mol. Its IUPAC name is ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride.
Molecular Properties
| Compound Name | ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride |
| PubChem CID | 158367193 |
| Molecular Formula | C15H30ClNO4 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)CC(C)(CCN)C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C15H29NO4.ClH/c1-13(2,3)19-11(17)10-15(7,8-9-16)12(18)20-14(4,5)6;/h8-10,16H2,1-7H3;1H |
| InChIKey | NQUALYZXGVEJRL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride?
The IUPAC name of ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride (CID 158367193) is ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride.
What is the SMILES notation for ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride?
The canonical SMILES for ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride is CC(C)(C)OC(=O)CC(C)(CCN)C(=O)OC(C)(C)C.Cl.
What is the InChIKey of ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride?
The InChIKey is NQUALYZXGVEJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO4.ClH/c1-13(2,3)19-11(17)10-15(7,8-9-16)12(18)20-14(4,5)6;/h8-10,16H2,1-7H3;1H.
What are the key properties of ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride?
ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride has a molecular weight of 323.86 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-(2-aminoethyl)-2-methylbutanedioate;hydrochloride is sourced from PubChem (CID 158367193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).