C11H21BrO2 — CID 167718322
tert-butyl 5-bromo-3,3-dimethylpentanoate (PubChem CID 167718322) has the molecular formula C11H21BrO2 and a molecular weight of 265.19 g/mol. Its IUPAC name is tert-butyl 5-bromo-3,3-dimethylpentanoate.
| Compound Name | tert-butyl 5-bromo-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 167718322 |
| Molecular Formula | C11H21BrO2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | tert-butyl 5-bromo-3,3-dimethylpentanoate |
| SMILES | CC(C)(CCBr)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21BrO2/c1-10(2,3)14-9(13)8-11(4,5)6-7-12/h6-8H2,1-5H3 |
| InChIKey | BSZHVIHSUDKWPQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|