C8H14O6 — CID 91245565
2,2-dihydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 91245565) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2,2-dihydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | 2,2-dihydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91245565 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,2-dihydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)CC(O)(O)C(=O)O |
| InChI | InChI=1S/C8H14O6/c1-7(2,3)14-5(9)4-8(12,13)6(10)11/h12-13H,4H2,1-3H3,(H,10,11) |
| InChIKey | XZINVCHLRJMQPL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|