C14H25NO7 — CID 161137810
tert-butyl 3-amino-3-oxopropanoate;3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 161137810) has the molecular formula C14H25NO7 and a molecular weight of 319.35 g/mol. Its IUPAC name is tert-butyl 3-amino-3-oxopropanoate;3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | tert-butyl 3-amino-3-oxopropanoate;3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 161137810 |
| Molecular Formula | C14H25NO7 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | tert-butyl 3-amino-3-oxopropanoate;3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)CC(=O)O.CC(C)(C)OC(=O)CC(N)=O |
| InChI | InChI=1S/C7H13NO3.C7H12O4/c2*1-7(2,3)11-6(10)4-5(8)9/h4H2,1-3H3,(H2,8,9);4H2,1-3H3,(H,8,9) |
| InChIKey | UNAKLNVDEINZQQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|