About tert-butyl 3-amino-3-methyliminopropanoate;ethane
tert-butyl 3-amino-3-methyliminopropanoate;ethane (PubChem CID 142912028) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is tert-butyl 3-amino-3-methyliminopropanoate;ethane.
Molecular Properties
| Compound Name | tert-butyl 3-amino-3-methyliminopropanoate;ethane |
| PubChem CID | 142912028 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | tert-butyl 3-amino-3-methyliminopropanoate;ethane |
| SMILES | C/N=C(\N)CC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C8H16N2O2.C2H6/c1-8(2,3)12-7(11)5-6(9)10-4;1-2/h5H2,1-4H3,(H2,9,10);1-2H3 |
| InChIKey | LMDLFMAUAVNKFJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-amino-3-methyliminopropanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-3-methyliminopropanoate;ethane?
The IUPAC name of tert-butyl 3-amino-3-methyliminopropanoate;ethane (CID 142912028) is tert-butyl 3-amino-3-methyliminopropanoate;ethane.
What is the SMILES notation for tert-butyl 3-amino-3-methyliminopropanoate;ethane?
The canonical SMILES for tert-butyl 3-amino-3-methyliminopropanoate;ethane is C/N=C(\N)CC(=O)OC(C)(C)C.CC.
What is the InChIKey of tert-butyl 3-amino-3-methyliminopropanoate;ethane?
The InChIKey is LMDLFMAUAVNKFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2.C2H6/c1-8(2,3)12-7(11)5-6(9)10-4;1-2/h5H2,1-4H3,(H2,9,10);1-2H3.
What are the key properties of tert-butyl 3-amino-3-methyliminopropanoate;ethane?
tert-butyl 3-amino-3-methyliminopropanoate;ethane has a molecular weight of 202.30 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-3-methyliminopropanoate;ethane is sourced from PubChem (CID 142912028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).