About tert-butyl 7-amino-7-oxoheptanoate
tert-butyl 7-amino-7-oxoheptanoate (PubChem CID 88902812) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl 7-amino-7-oxoheptanoate.
Molecular Properties
| Compound Name | tert-butyl 7-amino-7-oxoheptanoate |
| PubChem CID | 88902812 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl 7-amino-7-oxoheptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCC(N)=O |
| InChI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)8-6-4-5-7-9(12)13/h4-8H2,1-3H3,(H2,12,13) |
| InChIKey | KOZONSQGCOAPMA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 7-amino-7-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-amino-7-oxoheptanoate?
The IUPAC name of tert-butyl 7-amino-7-oxoheptanoate (CID 88902812) is tert-butyl 7-amino-7-oxoheptanoate.
What is the SMILES notation for tert-butyl 7-amino-7-oxoheptanoate?
The canonical SMILES for tert-butyl 7-amino-7-oxoheptanoate is CC(C)(C)OC(=O)CCCCCC(N)=O.
What is the InChIKey of tert-butyl 7-amino-7-oxoheptanoate?
The InChIKey is KOZONSQGCOAPMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)8-6-4-5-7-9(12)13/h4-8H2,1-3H3,(H2,12,13).
What are the key properties of tert-butyl 7-amino-7-oxoheptanoate?
tert-butyl 7-amino-7-oxoheptanoate has a molecular weight of 215.29 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-amino-7-oxoheptanoate is sourced from PubChem (CID 88902812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).