About butane;tert-butyl nonanoate
butane;tert-butyl nonanoate (PubChem CID 175191905) has the molecular formula C17H36O2
and a molecular weight of 272.47 g/mol. Its IUPAC name is butane;tert-butyl nonanoate.
Molecular Properties
| Compound Name | butane;tert-butyl nonanoate |
| PubChem CID | 175191905 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | butane;tert-butyl nonanoate |
| SMILES | CCCC.CCCCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26O2.C4H10/c1-5-6-7-8-9-10-11-12(14)15-13(2,3)4;1-3-4-2/h5-11H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | JMQQCSZGQFMQRX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;tert-butyl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;tert-butyl nonanoate?
The IUPAC name of butane;tert-butyl nonanoate (CID 175191905) is butane;tert-butyl nonanoate.
What is the SMILES notation for butane;tert-butyl nonanoate?
The canonical SMILES for butane;tert-butyl nonanoate is CCCC.CCCCCCCCC(=O)OC(C)(C)C.
What is the InChIKey of butane;tert-butyl nonanoate?
The InChIKey is JMQQCSZGQFMQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.C4H10/c1-5-6-7-8-9-10-11-12(14)15-13(2,3)4;1-3-4-2/h5-11H2,1-4H3;3-4H2,1-2H3.
What are the key properties of butane;tert-butyl nonanoate?
butane;tert-butyl nonanoate has a molecular weight of 272.47 g/mol, XLogP of 5.89, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;tert-butyl nonanoate is sourced from PubChem (CID 175191905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).