About tert-butyl octanoate;oxalic acid
tert-butyl octanoate;oxalic acid (PubChem CID 175523196) has the molecular formula C14H26O6
and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl octanoate;oxalic acid.
Molecular Properties
| Compound Name | tert-butyl octanoate;oxalic acid |
| PubChem CID | 175523196 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl octanoate;oxalic acid |
| SMILES | CCCCCCCC(=O)OC(C)(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H24O2.C2H2O4/c1-5-6-7-8-9-10-11(13)14-12(2,3)4;3-1(4)2(5)6/h5-10H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | KHERIOXCYJJSPJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl octanoate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl octanoate;oxalic acid?
The IUPAC name of tert-butyl octanoate;oxalic acid (CID 175523196) is tert-butyl octanoate;oxalic acid.
What is the SMILES notation for tert-butyl octanoate;oxalic acid?
The canonical SMILES for tert-butyl octanoate;oxalic acid is CCCCCCCC(=O)OC(C)(C)C.O=C(O)C(=O)O.
What is the InChIKey of tert-butyl octanoate;oxalic acid?
The InChIKey is KHERIOXCYJJSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C2H2O4/c1-5-6-7-8-9-10-11(13)14-12(2,3)4;3-1(4)2(5)6/h5-10H2,1-4H3;(H,3,4)(H,5,6).
What are the key properties of tert-butyl octanoate;oxalic acid?
tert-butyl octanoate;oxalic acid has a molecular weight of 290.36 g/mol, XLogP of 2.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl octanoate;oxalic acid is sourced from PubChem (CID 175523196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).