C14H21BrO6 — CID 11122076
1-O-tert-butyl 2-O,2-O-dimethyl 4-bromopent-4-ene-1,2,2-tricarboxylate (PubChem CID 11122076) has the molecular formula C14H21BrO6 and a molecular weight of 365.22 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,2-O-dimethyl 4-bromopent-4-ene-1,2,2-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,2-O-dimethyl 4-bromopent-4-ene-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 11122076 |
| Molecular Formula | C14H21BrO6 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-O-tert-butyl 2-O,2-O-dimethyl 4-bromopent-4-ene-1,2,2-tricarboxylate |
| SMILES | C=C(Br)CC(CC(=O)OC(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H21BrO6/c1-9(15)7-14(11(17)19-5,12(18)20-6)8-10(16)21-13(2,3)4/h1,7-8H2,2-6H3 |
| InChIKey | PAEVMXDAEQYWTK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|