C14H17BrO5 — CID 11359910
dimethyl 2-(2-bromoprop-2-enyl)-2-[(E)-5-methoxypent-4-en-2-ynyl]propanedioate (PubChem CID 11359910) has the molecular formula C14H17BrO5 and a molecular weight of 345.19 g/mol. Its IUPAC name is dimethyl 2-(2-bromoprop-2-enyl)-2-[(E)-5-methoxypent-4-en-2-ynyl]propanedioate.
| Compound Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[(E)-5-methoxypent-4-en-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 11359910 |
| Molecular Formula | C14H17BrO5 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | dimethyl 2-(2-bromoprop-2-enyl)-2-[(E)-5-methoxypent-4-en-2-ynyl]propanedioate |
| SMILES | C=C(Br)CC(CC#C/C=C/OC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H17BrO5/c1-11(15)10-14(12(16)19-3,13(17)20-4)8-6-5-7-9-18-2/h7,9H,1,8,10H2,2-4H3/b9-7+ |
| InChIKey | QYICRSUQTDMKEW-VQHVLOKHSA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|