C11H15BrO2 — CID 14140204
3-(2-bromoprop-2-enyl)-3-prop-2-enylpentane-2,4-dione (PubChem CID 14140204) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 3-(2-bromoprop-2-enyl)-3-prop-2-enylpentane-2,4-dione.
| Compound Name | 3-(2-bromoprop-2-enyl)-3-prop-2-enylpentane-2,4-dione |
|---|---|
| PubChem CID | 14140204 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 3-(2-bromoprop-2-enyl)-3-prop-2-enylpentane-2,4-dione |
| SMILES | C=CCC(CC(=C)Br)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H15BrO2/c1-5-6-11(9(3)13,10(4)14)7-8(2)12/h5H,1-2,6-7H2,3-4H3 |
| InChIKey | LOESXSJEAFALTE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|