C20H28O8 — CID 11349994
tetramethyl (6E)-dodeca-1,6,11-triene-3,3,8,8-tetracarboxylate (PubChem CID 11349994) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is tetramethyl (6E)-dodeca-1,6,11-triene-3,3,8,8-tetracarboxylate.
| Compound Name | tetramethyl (6E)-dodeca-1,6,11-triene-3,3,8,8-tetracarboxylate |
|---|---|
| PubChem CID | 11349994 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tetramethyl (6E)-dodeca-1,6,11-triene-3,3,8,8-tetracarboxylate |
| SMILES | C=CCC(C/C=C/CC(CC=C)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H28O8/c1-7-11-19(15(21)25-3,16(22)26-4)13-9-10-14-20(12-8-2,17(23)27-5)18(24)28-6/h7-10H,1-2,11-14H2,3-6H3/b10-9+ |
| InChIKey | ITXMVSZGSVDMTQ-MDZDMXLPSA-N |
| XLogP | 2.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|