C17H26O4 — CID 11415174
dimethyl 2-nona-2,3-dienyl-2-prop-2-enylpropanedioate (PubChem CID 11415174) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is dimethyl 2-nona-2,3-dienyl-2-prop-2-enylpropanedioate.
| Compound Name | dimethyl 2-nona-2,3-dienyl-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 11415174 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | dimethyl 2-nona-2,3-dienyl-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC=C=CCCCCC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H26O4/c1-5-7-8-9-10-11-12-14-17(13-6-2,15(18)20-3)16(19)21-4/h6,10,12H,2,5,7-9,13-14H2,1,3-4H3 |
| InChIKey | NCIOAURIDSXHSB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|