C21H38N2O2 — CID 91206718
N,N'-diethyl-2-prop-2-enyl-2-undec-2-enylpropanediamide (PubChem CID 91206718) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is N,N'-diethyl-2-prop-2-enyl-2-undec-2-enylpropanediamide.
| Compound Name | N,N'-diethyl-2-prop-2-enyl-2-undec-2-enylpropanediamide |
|---|---|
| PubChem CID | 91206718 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | N,N'-diethyl-2-prop-2-enyl-2-undec-2-enylpropanediamide |
| SMILES | C=CCC(CC=CCCCCCCCC)(C(=O)NCC)C(=O)NCC |
| InChI | InChI=1S/C21H38N2O2/c1-5-9-10-11-12-13-14-15-16-18-21(17-6-2,19(24)22-7-3)20(25)23-8-4/h6,15-16H,2,5,7-14,17-18H2,1,3-4H3,(H,22,24)(H,23,25) |
| InChIKey | PSOAUQOEPSUOQD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|