C13H19NO3 — CID 141295889
nona-2,3-dienylcarbamoyl prop-2-enoate (PubChem CID 141295889) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is nona-2,3-dienylcarbamoyl prop-2-enoate.
| Compound Name | nona-2,3-dienylcarbamoyl prop-2-enoate |
|---|---|
| PubChem CID | 141295889 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | nona-2,3-dienylcarbamoyl prop-2-enoate |
| SMILES | C=CC(=O)OC(=O)NCC=C=CCCCCC |
| InChI | InChI=1S/C13H19NO3/c1-3-5-6-7-8-9-10-11-14-13(16)17-12(15)4-2/h4,8,10H,2-3,5-7,11H2,1H3,(H,14,16) |
| InChIKey | WZYNJRHNMLZBNN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|