C12H17NO2 — CID 176543115
N-prop-2-enoylnona-2,3-dienamide (PubChem CID 176543115) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-prop-2-enoylnona-2,3-dienamide.
| Compound Name | N-prop-2-enoylnona-2,3-dienamide |
|---|---|
| PubChem CID | 176543115 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-prop-2-enoylnona-2,3-dienamide |
| SMILES | C=CC(=O)NC(=O)C=C=CCCCCC |
| InChI | InChI=1S/C12H17NO2/c1-3-5-6-7-8-9-10-12(15)13-11(14)4-2/h4,8,10H,2-3,5-7H2,1H3,(H,13,14,15) |
| InChIKey | IYKPPQILTQOLKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|