C15H19NO — CID 10998784
N-benzylocta-2,3-dienamide (PubChem CID 10998784) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-benzylocta-2,3-dienamide.
| Compound Name | N-benzylocta-2,3-dienamide |
|---|---|
| PubChem CID | 10998784 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-benzylocta-2,3-dienamide |
| SMILES | CCCCC=C=CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H19NO/c1-2-3-4-5-9-12-15(17)16-13-14-10-7-6-8-11-14/h5-8,10-12H,2-4,13H2,1H3,(H,16,17) |
| InChIKey | JHTOMWFRXDZRTF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|