About N-benzylprop-2-enamide;N-butylbutan-1-amine
N-benzylprop-2-enamide;N-butylbutan-1-amine (PubChem CID 66969925) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is N-benzylprop-2-enamide;N-butylbutan-1-amine.
Molecular Properties
| Compound Name | N-benzylprop-2-enamide;N-butylbutan-1-amine |
| PubChem CID | 66969925 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-benzylprop-2-enamide;N-butylbutan-1-amine |
| SMILES | C=CC(=O)NCc1ccccc1.CCCCNCCCC |
| InChI | InChI=1S/C10H11NO.C8H19N/c1-2-10(12)11-8-9-6-4-3-5-7-9;1-3-5-7-9-8-6-4-2/h2-7H,1,8H2,(H,11,12);9H,3-8H2,1-2H3 |
| InChIKey | JIFMVIFFLWMHQB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzylprop-2-enamide;N-butylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylprop-2-enamide;N-butylbutan-1-amine?
The IUPAC name of N-benzylprop-2-enamide;N-butylbutan-1-amine (CID 66969925) is N-benzylprop-2-enamide;N-butylbutan-1-amine.
What is the SMILES notation for N-benzylprop-2-enamide;N-butylbutan-1-amine?
The canonical SMILES for N-benzylprop-2-enamide;N-butylbutan-1-amine is C=CC(=O)NCc1ccccc1.CCCCNCCCC.
What is the InChIKey of N-benzylprop-2-enamide;N-butylbutan-1-amine?
The InChIKey is JIFMVIFFLWMHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C8H19N/c1-2-10(12)11-8-9-6-4-3-5-7-9;1-3-5-7-9-8-6-4-2/h2-7H,1,8H2,(H,11,12);9H,3-8H2,1-2H3.
What are the key properties of N-benzylprop-2-enamide;N-butylbutan-1-amine?
N-benzylprop-2-enamide;N-butylbutan-1-amine has a molecular weight of 290.45 g/mol, XLogP of 3.66, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylprop-2-enamide;N-butylbutan-1-amine is sourced from PubChem (CID 66969925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).