C16H22N2O2 — CID 174986700
N-benzylprop-2-enamide;2,3-dimethylbut-2-enamide (PubChem CID 174986700) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-benzylprop-2-enamide;2,3-dimethylbut-2-enamide.
| Compound Name | N-benzylprop-2-enamide;2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 174986700 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-benzylprop-2-enamide;2,3-dimethylbut-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1.CC(C)=C(C)C(N)=O |
| InChI | InChI=1S/C10H11NO.C6H11NO/c1-2-10(12)11-8-9-6-4-3-5-7-9;1-4(2)5(3)6(7)8/h2-7H,1,8H2,(H,11,12);1-3H3,(H2,7,8) |
| InChIKey | GZVJGKDXVGLBFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|