C15H21BrFNO2 — CID 71740857
(2S,3R)-N-benzyl-2-bromo-2-fluoro-3-hydroxyoctanamide (PubChem CID 71740857) has the molecular formula C15H21BrFNO2 and a molecular weight of 346.24 g/mol. Its IUPAC name is (2S,3R)-N-benzyl-2-bromo-2-fluoro-3-hydroxyoctanamide.
| Compound Name | (2S,3R)-N-benzyl-2-bromo-2-fluoro-3-hydroxyoctanamide |
|---|---|
| PubChem CID | 71740857 |
| Molecular Formula | C15H21BrFNO2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (2S,3R)-N-benzyl-2-bromo-2-fluoro-3-hydroxyoctanamide |
| SMILES | CCCCC[C@@H](O)[C@](F)(Br)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H21BrFNO2/c1-2-3-5-10-13(19)15(16,17)14(20)18-11-12-8-6-4-7-9-12/h4,6-9,13,19H,2-3,5,10-11H2,1H3,(H,18,20)/t13-,15-/m1/s1 |
| InChIKey | RERVYYLKGAIRRY-UKRRQHHQSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|