C15H24N2O2 — CID 95984730
1-benzyl-3-[(3R)-3-hydroxy-4,4-dimethylpentyl]urea (PubChem CID 95984730) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-benzyl-3-[(3R)-3-hydroxy-4,4-dimethylpentyl]urea.
| Compound Name | 1-benzyl-3-[(3R)-3-hydroxy-4,4-dimethylpentyl]urea |
|---|---|
| PubChem CID | 95984730 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-benzyl-3-[(3R)-3-hydroxy-4,4-dimethylpentyl]urea |
| SMILES | CC(C)(C)[C@H](O)CCNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,3)13(18)9-10-16-14(19)17-11-12-7-5-4-6-8-12/h4-8,13,18H,9-11H2,1-3H3,(H2,16,17,19)/t13-/m1/s1 |
| InChIKey | HARWJFZGHVNEOE-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |