C13H16F3NO3 — CID 121376746
(2S,4R)-N-benzyl-5,5,5-trifluoro-2,4-dihydroxy-2-methylpentanamide (PubChem CID 121376746) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is (2S,4R)-N-benzyl-5,5,5-trifluoro-2,4-dihydroxy-2-methylpentanamide.
| Compound Name | (2S,4R)-N-benzyl-5,5,5-trifluoro-2,4-dihydroxy-2-methylpentanamide |
|---|---|
| PubChem CID | 121376746 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2S,4R)-N-benzyl-5,5,5-trifluoro-2,4-dihydroxy-2-methylpentanamide |
| SMILES | C[C@](O)(C[C@@H](O)C(F)(F)F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H16F3NO3/c1-12(20,7-10(18)13(14,15)16)11(19)17-8-9-5-3-2-4-6-9/h2-6,10,18,20H,7-8H2,1H3,(H,17,19)/t10-,12+/m1/s1 |
| InChIKey | XNGGICMDMWBYBC-PWSUYJOCSA-N |
| XLogP | 1.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |