C12H8F9NO — CID 4525398
N-benzyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 4525398) has the molecular formula C12H8F9NO and a molecular weight of 353.18 g/mol. Its IUPAC name is N-benzyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-benzyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 4525398 |
| Molecular Formula | C12H8F9NO |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-benzyl-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | O=C(NCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F9NO/c13-9(14,10(15,16)11(17,18)12(19,20)21)8(23)22-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,22,23) |
| InChIKey | QEMFDPGAWPIOHK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|