C12H10F7NO2 — CID 3253809
2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxy-2-phenylethyl)butanamide (PubChem CID 3253809) has the molecular formula C12H10F7NO2 and a molecular weight of 333.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxy-2-phenylethyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxy-2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 3253809 |
| Molecular Formula | C12H10F7NO2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxy-2-phenylethyl)butanamide |
| SMILES | O=C(NCC(O)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F7NO2/c13-10(14,11(15,16)12(17,18)19)9(22)20-6-8(21)7-4-2-1-3-5-7/h1-5,8,21H,6H2,(H,20,22) |
| InChIKey | MXFOGULKLYEYPW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|