C16H14F3NO — CID 59644379
N-(2,2-diphenylethyl)-2,2,2-trifluoroacetamide (PubChem CID 59644379) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2,2-diphenylethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59644379 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(2,2-diphenylethyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO/c17-16(18,19)15(21)20-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14H,11H2,(H,20,21) |
| InChIKey | AROLBSOPOGMTJW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |