C12H12F3NO3 — CID 96582816
(3R)-3-phenyl-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 96582816) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is (3R)-3-phenyl-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
| Compound Name | (3R)-3-phenyl-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 96582816 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (3R)-3-phenyl-4-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| SMILES | O=C(O)C[C@@H](CNC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO3/c13-12(14,15)11(19)16-7-9(6-10(17)18)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,16,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | YEOBLYWGVANAGU-VIFPVBQESA-N |
| XLogP | 1.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |